C14H16N2OS2 — CID 63915620
4-cyclopropyl-2-[methyl(1-thiophen-2-ylethyl)amino]-1,3-thiazole-5-carbaldehyde (PubChem CID 63915620) has the molecular formula C14H16N2OS2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 4-cyclopropyl-2-[methyl(1-thiophen-2-ylethyl)amino]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-cyclopropyl-2-[methyl(1-thiophen-2-ylethyl)amino]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 63915620 |
| Molecular Formula | C14H16N2OS2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-cyclopropyl-2-[methyl(1-thiophen-2-ylethyl)amino]-1,3-thiazole-5-carbaldehyde |
| SMILES | CC(c1cccs1)N(C)c1nc(C2CC2)c(C=O)s1 |
| InChI | InChI=1S/C14H16N2OS2/c1-9(11-4-3-7-18-11)16(2)14-15-13(10-5-6-10)12(8-17)19-14/h3-4,7-10H,5-6H2,1-2H3 |
| InChIKey | GXDIEVYRNYDMQA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|