C16H27N3OS — CID 63915788
N-[[4-cyclopropyl-2-(2,5-dimethylmorpholin-4-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 63915788) has the molecular formula C16H27N3OS and a molecular weight of 309.48 g/mol. Its IUPAC name is N-[[4-cyclopropyl-2-(2,5-dimethylmorpholin-4-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[4-cyclopropyl-2-(2,5-dimethylmorpholin-4-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63915788 |
| Molecular Formula | C16H27N3OS |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | N-[[4-cyclopropyl-2-(2,5-dimethylmorpholin-4-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc(N2CC(C)OCC2C)nc1C1CC1 |
| InChI | InChI=1S/C16H27N3OS/c1-4-7-17-8-14-15(13-5-6-13)18-16(21-14)19-9-12(3)20-10-11(19)2/h11-13,17H,4-10H2,1-3H3 |
| InChIKey | KADSASADUFDMGT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|