C14H23N3O2S2 — CID 63917159
N-[[4-cyclopropyl-2-(1,1-dioxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 63917159) has the molecular formula C14H23N3O2S2 and a molecular weight of 329.49 g/mol. Its IUPAC name is N-[[4-cyclopropyl-2-(1,1-dioxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[4-cyclopropyl-2-(1,1-dioxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63917159 |
| Molecular Formula | C14H23N3O2S2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-[[4-cyclopropyl-2-(1,1-dioxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc(N2CCS(=O)(=O)CC2)nc1C1CC1 |
| InChI | InChI=1S/C14H23N3O2S2/c1-2-5-15-10-12-13(11-3-4-11)16-14(20-12)17-6-8-21(18,19)9-7-17/h11,15H,2-10H2,1H3 |
| InChIKey | MICJAUZHHZESOT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|