C13H16BrNO2S — CID 63918691
methyl 2-amino-3-(3-bromophenyl)sulfanyl-2-cyclopropylpropanoate (PubChem CID 63918691) has the molecular formula C13H16BrNO2S and a molecular weight of 330.25 g/mol. Its IUPAC name is methyl 2-amino-3-(3-bromophenyl)sulfanyl-2-cyclopropylpropanoate.
| Compound Name | methyl 2-amino-3-(3-bromophenyl)sulfanyl-2-cyclopropylpropanoate |
|---|---|
| PubChem CID | 63918691 |
| Molecular Formula | C13H16BrNO2S |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | methyl 2-amino-3-(3-bromophenyl)sulfanyl-2-cyclopropylpropanoate |
| SMILES | COC(=O)C(N)(CSc1cccc(Br)c1)C1CC1 |
| InChI | InChI=1S/C13H16BrNO2S/c1-17-12(16)13(15,9-5-6-9)8-18-11-4-2-3-10(14)7-11/h2-4,7,9H,5-6,8,15H2,1H3 |
| InChIKey | YQGNCLIYNZSRNX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |