C14H19NO2S — CID 63917659
methyl 2-amino-2-cyclopropyl-3-(4-methylphenyl)sulfanylpropanoate (PubChem CID 63917659) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is methyl 2-amino-2-cyclopropyl-3-(4-methylphenyl)sulfanylpropanoate.
| Compound Name | methyl 2-amino-2-cyclopropyl-3-(4-methylphenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 63917659 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | methyl 2-amino-2-cyclopropyl-3-(4-methylphenyl)sulfanylpropanoate |
| SMILES | COC(=O)C(N)(CSc1ccc(C)cc1)C1CC1 |
| InChI | InChI=1S/C14H19NO2S/c1-10-3-7-12(8-4-10)18-9-14(15,11-5-6-11)13(16)17-2/h3-4,7-8,11H,5-6,9,15H2,1-2H3 |
| InChIKey | RDZDCNGLIYAOBO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |