C11H17N5O2S — CID 63918063
methyl 2-amino-2-cyclopropyl-3-(1-cyclopropyltetrazol-5-yl)sulfanylpropanoate (PubChem CID 63918063) has the molecular formula C11H17N5O2S and a molecular weight of 283.36 g/mol. Its IUPAC name is methyl 2-amino-2-cyclopropyl-3-(1-cyclopropyltetrazol-5-yl)sulfanylpropanoate.
| Compound Name | methyl 2-amino-2-cyclopropyl-3-(1-cyclopropyltetrazol-5-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 63918063 |
| Molecular Formula | C11H17N5O2S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | methyl 2-amino-2-cyclopropyl-3-(1-cyclopropyltetrazol-5-yl)sulfanylpropanoate |
| SMILES | COC(=O)C(N)(CSc1nnnn1C1CC1)C1CC1 |
| InChI | InChI=1S/C11H17N5O2S/c1-18-9(17)11(12,7-2-3-7)6-19-10-13-14-15-16(10)8-4-5-8/h7-8H,2-6,12H2,1H3 |
| InChIKey | MVAKDLVHZQNFFI-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |