C15H21NO3S — CID 63917282
ethyl 2-amino-2-cyclopropyl-3-(3-methoxyphenyl)sulfanylpropanoate (PubChem CID 63917282) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is ethyl 2-amino-2-cyclopropyl-3-(3-methoxyphenyl)sulfanylpropanoate.
| Compound Name | ethyl 2-amino-2-cyclopropyl-3-(3-methoxyphenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 63917282 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | ethyl 2-amino-2-cyclopropyl-3-(3-methoxyphenyl)sulfanylpropanoate |
| SMILES | CCOC(=O)C(N)(CSc1cccc(OC)c1)C1CC1 |
| InChI | InChI=1S/C15H21NO3S/c1-3-19-14(17)15(16,11-7-8-11)10-20-13-6-4-5-12(9-13)18-2/h4-6,9,11H,3,7-8,10,16H2,1-2H3 |
| InChIKey | OSSNDOXNDCCZPD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |