C16H23NO4 — CID 63984055
ethyl 2-amino-2-cyclopropyl-3-[3-(methoxymethyl)phenoxy]propanoate (PubChem CID 63984055) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is ethyl 2-amino-2-cyclopropyl-3-[3-(methoxymethyl)phenoxy]propanoate.
| Compound Name | ethyl 2-amino-2-cyclopropyl-3-[3-(methoxymethyl)phenoxy]propanoate |
|---|---|
| PubChem CID | 63984055 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | ethyl 2-amino-2-cyclopropyl-3-[3-(methoxymethyl)phenoxy]propanoate |
| SMILES | CCOC(=O)C(N)(COc1cccc(COC)c1)C1CC1 |
| InChI | InChI=1S/C16H23NO4/c1-3-20-15(18)16(17,13-7-8-13)11-21-14-6-4-5-12(9-14)10-19-2/h4-6,9,13H,3,7-8,10-11,17H2,1-2H3 |
| InChIKey | CVTJCZIWXKGMJO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |