C15H27N3O2 — CID 63925815
methyl 2-amino-2-cyclopropyl-3-(3-pyrrolidin-1-ylpyrrolidin-1-yl)propanoate (PubChem CID 63925815) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is methyl 2-amino-2-cyclopropyl-3-(3-pyrrolidin-1-ylpyrrolidin-1-yl)propanoate.
| Compound Name | methyl 2-amino-2-cyclopropyl-3-(3-pyrrolidin-1-ylpyrrolidin-1-yl)propanoate |
|---|---|
| PubChem CID | 63925815 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | methyl 2-amino-2-cyclopropyl-3-(3-pyrrolidin-1-ylpyrrolidin-1-yl)propanoate |
| SMILES | COC(=O)C(N)(CN1CCC(N2CCCC2)C1)C1CC1 |
| InChI | InChI=1S/C15H27N3O2/c1-20-14(19)15(16,12-4-5-12)11-17-9-6-13(10-17)18-7-2-3-8-18/h12-13H,2-11,16H2,1H3 |
| InChIKey | UIDXDYHKAPENDD-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |