C12H23N3O4S — CID 63927438
methyl 2-amino-2-cyclopropyl-3-(4-methylsulfonylpiperazin-1-yl)propanoate (PubChem CID 63927438) has the molecular formula C12H23N3O4S and a molecular weight of 305.40 g/mol. Its IUPAC name is methyl 2-amino-2-cyclopropyl-3-(4-methylsulfonylpiperazin-1-yl)propanoate.
| Compound Name | methyl 2-amino-2-cyclopropyl-3-(4-methylsulfonylpiperazin-1-yl)propanoate |
|---|---|
| PubChem CID | 63927438 |
| Molecular Formula | C12H23N3O4S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | methyl 2-amino-2-cyclopropyl-3-(4-methylsulfonylpiperazin-1-yl)propanoate |
| SMILES | COC(=O)C(N)(CN1CCN(S(C)(=O)=O)CC1)C1CC1 |
| InChI | InChI=1S/C12H23N3O4S/c1-19-11(16)12(13,10-3-4-10)9-14-5-7-15(8-6-14)20(2,17)18/h10H,3-9,13H2,1-2H3 |
| InChIKey | MVCXBTBDYYYKFH-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |