C8H18O3S — CID 63930065
1-methoxy-3-(3-methoxypropylsulfanyl)propan-2-ol (PubChem CID 63930065) has the molecular formula C8H18O3S and a molecular weight of 194.30 g/mol. Its IUPAC name is 1-methoxy-3-(3-methoxypropylsulfanyl)propan-2-ol.
| Compound Name | 1-methoxy-3-(3-methoxypropylsulfanyl)propan-2-ol |
|---|---|
| PubChem CID | 63930065 |
| Molecular Formula | C8H18O3S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 1-methoxy-3-(3-methoxypropylsulfanyl)propan-2-ol |
| SMILES | COCCCSCC(O)COC |
| InChI | InChI=1S/C8H18O3S/c1-10-4-3-5-12-7-8(9)6-11-2/h8-9H,3-7H2,1-2H3 |
| InChIKey | QCXXUEHVMUYNHQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|