C8H18O4S — CID 79682128
3-[2-(2-methoxyethoxy)ethylsulfanyl]propane-1,2-diol (PubChem CID 79682128) has the molecular formula C8H18O4S and a molecular weight of 210.29 g/mol. Its IUPAC name is 3-[2-(2-methoxyethoxy)ethylsulfanyl]propane-1,2-diol.
| Compound Name | 3-[2-(2-methoxyethoxy)ethylsulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 79682128 |
| Molecular Formula | C8H18O4S |
| Molecular Weight | 210.29 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 3-[2-(2-methoxyethoxy)ethylsulfanyl]propane-1,2-diol |
| SMILES | COCCOCCSCC(O)CO |
| InChI | InChI=1S/C8H18O4S/c1-11-2-3-12-4-5-13-7-8(10)6-9/h8-10H,2-7H2,1H3 |
| InChIKey | RIEXILNBJKSJKV-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.29 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|