C11H23O2S3- — CID 155648006
1-[1-[2-(2-methoxyethoxy)ethylsulfanyl]propan-2-ylsulfanyl]propane-2-thiolate (PubChem CID 155648006) has the molecular formula C11H23O2S3- and a molecular weight of 283.50 g/mol. Its IUPAC name is 1-[1-[2-(2-methoxyethoxy)ethylsulfanyl]propan-2-ylsulfanyl]propane-2-thiolate.
| Compound Name | 1-[1-[2-(2-methoxyethoxy)ethylsulfanyl]propan-2-ylsulfanyl]propane-2-thiolate |
|---|---|
| PubChem CID | 155648006 |
| Molecular Formula | C11H23O2S3- |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 1-[1-[2-(2-methoxyethoxy)ethylsulfanyl]propan-2-ylsulfanyl]propane-2-thiolate |
| SMILES | COCCOCCSCC(C)SCC(C)[S-] |
| InChI | InChI=1S/C11H24O2S3/c1-10(14)8-16-11(2)9-15-7-6-13-5-4-12-3/h10-11,14H,4-9H2,1-3H3/p-1 |
| InChIKey | ITADENMYLFGYQT-UHFFFAOYSA-M |
| XLogP | 2.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|