C9H21NO2S — CID 103180189
1-[2-(3-methoxypropoxy)ethylsulfanyl]propan-2-amine (PubChem CID 103180189) has the molecular formula C9H21NO2S and a molecular weight of 207.34 g/mol. Its IUPAC name is 1-[2-(3-methoxypropoxy)ethylsulfanyl]propan-2-amine.
| Compound Name | 1-[2-(3-methoxypropoxy)ethylsulfanyl]propan-2-amine |
|---|---|
| PubChem CID | 103180189 |
| Molecular Formula | C9H21NO2S |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 1-[2-(3-methoxypropoxy)ethylsulfanyl]propan-2-amine |
| SMILES | COCCCOCCSCC(C)N |
| InChI | InChI=1S/C9H21NO2S/c1-9(10)8-13-7-6-12-5-3-4-11-2/h9H,3-8,10H2,1-2H3 |
| InChIKey | JOVKSBDMMNHAIQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|