C9H20O3S — CID 66105162
3-[2-(2-methoxyethoxy)ethylsulfanyl]-2-methylpropan-1-ol (PubChem CID 66105162) has the molecular formula C9H20O3S and a molecular weight of 208.32 g/mol. Its IUPAC name is 3-[2-(2-methoxyethoxy)ethylsulfanyl]-2-methylpropan-1-ol.
| Compound Name | 3-[2-(2-methoxyethoxy)ethylsulfanyl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 66105162 |
| Molecular Formula | C9H20O3S |
| Molecular Weight | 208.32 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 3-[2-(2-methoxyethoxy)ethylsulfanyl]-2-methylpropan-1-ol |
| SMILES | COCCOCCSCC(C)CO |
| InChI | InChI=1S/C9H20O3S/c1-9(7-10)8-13-6-5-12-4-3-11-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | BIQGCOUFWAYUIY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|