C12H26O6S2 — CID 130376503
3-[2-(2,3-dihydroxypropylsulfanyl)-3-(2-methoxyethoxy)propyl]sulfanylpropane-1,2-diol (PubChem CID 130376503) has the molecular formula C12H26O6S2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 3-[2-(2,3-dihydroxypropylsulfanyl)-3-(2-methoxyethoxy)propyl]sulfanylpropane-1,2-diol.
| Compound Name | 3-[2-(2,3-dihydroxypropylsulfanyl)-3-(2-methoxyethoxy)propyl]sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 130376503 |
| Molecular Formula | C12H26O6S2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3-[2-(2,3-dihydroxypropylsulfanyl)-3-(2-methoxyethoxy)propyl]sulfanylpropane-1,2-diol |
| SMILES | COCCOCC(CSCC(O)CO)SCC(O)CO |
| InChI | InChI=1S/C12H26O6S2/c1-17-2-3-18-6-12(20-8-11(16)5-14)9-19-7-10(15)4-13/h10-16H,2-9H2,1H3 |
| InChIKey | CIQUGZSMFLUTHV-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|