C15H25NO5S2 — CID 177455038
3-[3-(4-aminophenoxy)-2-(2,3-dihydroxypropylsulfanyl)propyl]sulfanylpropane-1,2-diol (PubChem CID 177455038) has the molecular formula C15H25NO5S2 and a molecular weight of 363.50 g/mol. Its IUPAC name is 3-[3-(4-aminophenoxy)-2-(2,3-dihydroxypropylsulfanyl)propyl]sulfanylpropane-1,2-diol.
| Compound Name | 3-[3-(4-aminophenoxy)-2-(2,3-dihydroxypropylsulfanyl)propyl]sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 177455038 |
| Molecular Formula | C15H25NO5S2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 3-[3-(4-aminophenoxy)-2-(2,3-dihydroxypropylsulfanyl)propyl]sulfanylpropane-1,2-diol |
| SMILES | Nc1ccc(OCC(CSCC(O)CO)SCC(O)CO)cc1 |
| InChI | InChI=1S/C15H25NO5S2/c16-11-1-3-14(4-2-11)21-7-15(23-9-13(20)6-18)10-22-8-12(19)5-17/h1-4,12-13,15,17-20H,5-10,16H2 |
| InChIKey | FAFABNXSGWWMOB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|