C13H19NO4S — CID 62268640
methyl 3-[3-(4-aminophenoxy)-2-hydroxypropyl]sulfanylpropanoate (PubChem CID 62268640) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is methyl 3-[3-(4-aminophenoxy)-2-hydroxypropyl]sulfanylpropanoate.
| Compound Name | methyl 3-[3-(4-aminophenoxy)-2-hydroxypropyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 62268640 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | methyl 3-[3-(4-aminophenoxy)-2-hydroxypropyl]sulfanylpropanoate |
| SMILES | COC(=O)CCSCC(O)COc1ccc(N)cc1 |
| InChI | InChI=1S/C13H19NO4S/c1-17-13(16)6-7-19-9-11(15)8-18-12-4-2-10(14)3-5-12/h2-5,11,15H,6-9,14H2,1H3 |
| InChIKey | MKBVKPYBHMGOBF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|