C22H34O10S3 — CID 164762983
methyl 3-[[3-[3-[3-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropoxy]phenoxy]-2-hydroxypropoxy]-3-oxopropyl]disulfanyl]propanoate (PubChem CID 164762983) has the molecular formula C22H34O10S3 and a molecular weight of 554.71 g/mol. Its IUPAC name is methyl 3-[[3-[3-[3-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropoxy]phenoxy]-2-hydroxypropoxy]-3-oxopropyl]disulfanyl]propanoate.
| Compound Name | methyl 3-[[3-[3-[3-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropoxy]phenoxy]-2-hydroxypropoxy]-3-oxopropyl]disulfanyl]propanoate |
|---|---|
| PubChem CID | 164762983 |
| Molecular Formula | C22H34O10S3 |
| Molecular Weight | 554.71 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | methyl 3-[[3-[3-[3-[3-(2,3-dihydroxypropylsulfanyl)-2-hydroxypropoxy]phenoxy]-2-hydroxypropoxy]-3-oxopropyl]disulfanyl]propanoate |
| SMILES | COC(=O)CCSSCCC(=O)OCC(O)COc1cccc(OCC(O)CSCC(O)CO)c1 |
| InChI | InChI=1S/C22H34O10S3/c1-29-21(27)5-7-34-35-8-6-22(28)32-12-17(25)11-30-19-3-2-4-20(9-19)31-13-18(26)15-33-14-16(24)10-23/h2-4,9,16-18,23-26H,5-8,10-15H2,1H3 |
| InChIKey | LYGXTGRUVYWEOD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.71 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|