C18H30O6S2 — CID 23389602
1-[3-[2-hydroxy-3-(2-methoxyethylsulfanyl)propoxy]phenoxy]-3-(2-methoxyethylsulfanyl)propan-2-ol (PubChem CID 23389602) has the molecular formula C18H30O6S2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 1-[3-[2-hydroxy-3-(2-methoxyethylsulfanyl)propoxy]phenoxy]-3-(2-methoxyethylsulfanyl)propan-2-ol.
| Compound Name | 1-[3-[2-hydroxy-3-(2-methoxyethylsulfanyl)propoxy]phenoxy]-3-(2-methoxyethylsulfanyl)propan-2-ol |
|---|---|
| PubChem CID | 23389602 |
| Molecular Formula | C18H30O6S2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 1-[3-[2-hydroxy-3-(2-methoxyethylsulfanyl)propoxy]phenoxy]-3-(2-methoxyethylsulfanyl)propan-2-ol |
| SMILES | COCCSCC(O)COc1cccc(OCC(O)CSCCOC)c1 |
| InChI | InChI=1S/C18H30O6S2/c1-21-6-8-25-13-15(19)11-23-17-4-3-5-18(10-17)24-12-16(20)14-26-9-7-22-2/h3-5,10,15-16,19-20H,6-9,11-14H2,1-2H3 |
| InChIKey | GLNWUXPFPRYRIC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|