About (2-fluorophenyl)methyl 2-piperidin-3-ylacetate
(2-fluorophenyl)methyl 2-piperidin-3-ylacetate (PubChem CID 63932202) has the molecular formula C14H18FNO2
and a molecular weight of 251.30 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 2-piperidin-3-ylacetate.
Molecular Properties
| Compound Name | (2-fluorophenyl)methyl 2-piperidin-3-ylacetate |
| PubChem CID | 63932202 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (2-fluorophenyl)methyl 2-piperidin-3-ylacetate |
| SMILES | O=C(CC1CCCNC1)OCc1ccccc1F |
| InChI | InChI=1S/C14H18FNO2/c15-13-6-2-1-5-12(13)10-18-14(17)8-11-4-3-7-16-9-11/h1-2,5-6,11,16H,3-4,7-10H2 |
| InChIKey | VQOSAXQKMNYHFY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-fluorophenyl)methyl 2-piperidin-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl)methyl 2-piperidin-3-ylacetate?
The IUPAC name of (2-fluorophenyl)methyl 2-piperidin-3-ylacetate (CID 63932202) is (2-fluorophenyl)methyl 2-piperidin-3-ylacetate.
What is the SMILES notation for (2-fluorophenyl)methyl 2-piperidin-3-ylacetate?
The canonical SMILES for (2-fluorophenyl)methyl 2-piperidin-3-ylacetate is O=C(CC1CCCNC1)OCc1ccccc1F.
What is the InChIKey of (2-fluorophenyl)methyl 2-piperidin-3-ylacetate?
The InChIKey is VQOSAXQKMNYHFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FNO2/c15-13-6-2-1-5-12(13)10-18-14(17)8-11-4-3-7-16-9-11/h1-2,5-6,11,16H,3-4,7-10H2.
What are the key properties of (2-fluorophenyl)methyl 2-piperidin-3-ylacetate?
(2-fluorophenyl)methyl 2-piperidin-3-ylacetate has a molecular weight of 251.30 g/mol, XLogP of 2.26, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl)methyl 2-piperidin-3-ylacetate is sourced from PubChem (CID 63932202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).