About (2-fluorophenyl)methyl piperidine-4-carboxylate
(2-fluorophenyl)methyl piperidine-4-carboxylate (PubChem CID 63933211) has the molecular formula C13H16FNO2
and a molecular weight of 237.27 g/mol. Its IUPAC name is (2-fluorophenyl)methyl piperidine-4-carboxylate.
Molecular Properties
| Compound Name | (2-fluorophenyl)methyl piperidine-4-carboxylate |
| PubChem CID | 63933211 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (2-fluorophenyl)methyl piperidine-4-carboxylate |
| SMILES | O=C(OCc1ccccc1F)C1CCNCC1 |
| InChI | InChI=1S/C13H16FNO2/c14-12-4-2-1-3-11(12)9-17-13(16)10-5-7-15-8-6-10/h1-4,10,15H,5-9H2 |
| InChIKey | OHHVFOHJBZYITD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-fluorophenyl)methyl piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl)methyl piperidine-4-carboxylate?
The IUPAC name of (2-fluorophenyl)methyl piperidine-4-carboxylate (CID 63933211) is (2-fluorophenyl)methyl piperidine-4-carboxylate.
What is the SMILES notation for (2-fluorophenyl)methyl piperidine-4-carboxylate?
The canonical SMILES for (2-fluorophenyl)methyl piperidine-4-carboxylate is O=C(OCc1ccccc1F)C1CCNCC1.
What is the InChIKey of (2-fluorophenyl)methyl piperidine-4-carboxylate?
The InChIKey is OHHVFOHJBZYITD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FNO2/c14-12-4-2-1-3-11(12)9-17-13(16)10-5-7-15-8-6-10/h1-4,10,15H,5-9H2.
What are the key properties of (2-fluorophenyl)methyl piperidine-4-carboxylate?
(2-fluorophenyl)methyl piperidine-4-carboxylate has a molecular weight of 237.27 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl)methyl piperidine-4-carboxylate is sourced from PubChem (CID 63933211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).