C17H20FNO3 — CID 60612350
(2-fluorophenyl)methyl 1-(cyclopropanecarbonyl)piperidine-3-carboxylate (PubChem CID 60612350) has the molecular formula C17H20FNO3 and a molecular weight of 305.35 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 1-(cyclopropanecarbonyl)piperidine-3-carboxylate.
| Compound Name | (2-fluorophenyl)methyl 1-(cyclopropanecarbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 60612350 |
| Molecular Formula | C17H20FNO3 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (2-fluorophenyl)methyl 1-(cyclopropanecarbonyl)piperidine-3-carboxylate |
| SMILES | O=C(OCc1ccccc1F)C1CCCN(C(=O)C2CC2)C1 |
| InChI | InChI=1S/C17H20FNO3/c18-15-6-2-1-4-14(15)11-22-17(21)13-5-3-9-19(10-13)16(20)12-7-8-12/h1-2,4,6,12-13H,3,5,7-11H2 |
| InChIKey | ZCEVCMBPRMJKKL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |