C17H26FNO — CID 63932831
N-[[1-[(2-fluorophenyl)methoxy]cycloheptyl]methyl]ethanamine (PubChem CID 63932831) has the molecular formula C17H26FNO and a molecular weight of 279.40 g/mol. Its IUPAC name is N-[[1-[(2-fluorophenyl)methoxy]cycloheptyl]methyl]ethanamine.
| Compound Name | N-[[1-[(2-fluorophenyl)methoxy]cycloheptyl]methyl]ethanamine |
|---|---|
| PubChem CID | 63932831 |
| Molecular Formula | C17H26FNO |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | N-[[1-[(2-fluorophenyl)methoxy]cycloheptyl]methyl]ethanamine |
| SMILES | CCNCC1(OCc2ccccc2F)CCCCCC1 |
| InChI | InChI=1S/C17H26FNO/c1-2-19-14-17(11-7-3-4-8-12-17)20-13-15-9-5-6-10-16(15)18/h5-6,9-10,19H,2-4,7-8,11-14H2,1H3 |
| InChIKey | BZVFCWSZOURQLA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |