C18H26FNO — CID 63934652
N-[[1-[(2-fluorophenyl)methoxy]cycloheptyl]methyl]cyclopropanamine (PubChem CID 63934652) has the molecular formula C18H26FNO and a molecular weight of 291.41 g/mol. Its IUPAC name is N-[[1-[(2-fluorophenyl)methoxy]cycloheptyl]methyl]cyclopropanamine.
| Compound Name | N-[[1-[(2-fluorophenyl)methoxy]cycloheptyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 63934652 |
| Molecular Formula | C18H26FNO |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | N-[[1-[(2-fluorophenyl)methoxy]cycloheptyl]methyl]cyclopropanamine |
| SMILES | Fc1ccccc1COC1(CNC2CC2)CCCCCC1 |
| InChI | InChI=1S/C18H26FNO/c19-17-8-4-3-7-15(17)13-21-18(14-20-16-9-10-16)11-5-1-2-6-12-18/h3-4,7-8,16,20H,1-2,5-6,9-14H2 |
| InChIKey | OPFFTVBWBYQPKC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |