C12H17F2NO2 — CID 63933180
1-[(3,4-difluorophenyl)methylamino]-3-ethoxypropan-2-ol (PubChem CID 63933180) has the molecular formula C12H17F2NO2 and a molecular weight of 245.27 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methylamino]-3-ethoxypropan-2-ol.
| Compound Name | 1-[(3,4-difluorophenyl)methylamino]-3-ethoxypropan-2-ol |
|---|---|
| PubChem CID | 63933180 |
| Molecular Formula | C12H17F2NO2 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methylamino]-3-ethoxypropan-2-ol |
| SMILES | CCOCC(O)CNCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H17F2NO2/c1-2-17-8-10(16)7-15-6-9-3-4-11(13)12(14)5-9/h3-5,10,15-16H,2,6-8H2,1H3 |
| InChIKey | HAAICZBRRLZBMC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |