C10H16F3NO — CID 639392
(4R,5S)-5-pentyl-4-(trifluoromethyl)pyrrolidin-2-one (PubChem CID 639392) has the molecular formula C10H16F3NO and a molecular weight of 223.24 g/mol. Its IUPAC name is (4R,5S)-5-pentyl-4-(trifluoromethyl)pyrrolidin-2-one.
| Compound Name | (4R,5S)-5-pentyl-4-(trifluoromethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 639392 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (4R,5S)-5-pentyl-4-(trifluoromethyl)pyrrolidin-2-one |
| SMILES | CCCCC[C@@H]1NC(=O)C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C10H16F3NO/c1-2-3-4-5-8-7(10(11,12)13)6-9(15)14-8/h7-8H,2-6H2,1H3,(H,14,15)/t7-,8+/m1/s1 |
| InChIKey | OCISRYXDGOPRFZ-SFYZADRCSA-N |
| XLogP | 2.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|