C11H11NO4S — CID 63943351
5-[1-oxo-1-(prop-2-ynylamino)propan-2-yl]sulfanylfuran-2-carboxylic acid (PubChem CID 63943351) has the molecular formula C11H11NO4S and a molecular weight of 253.28 g/mol. Its IUPAC name is 5-[1-oxo-1-(prop-2-ynylamino)propan-2-yl]sulfanylfuran-2-carboxylic acid.
| Compound Name | 5-[1-oxo-1-(prop-2-ynylamino)propan-2-yl]sulfanylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 63943351 |
| Molecular Formula | C11H11NO4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 5-[1-oxo-1-(prop-2-ynylamino)propan-2-yl]sulfanylfuran-2-carboxylic acid |
| SMILES | C#CCNC(=O)C(C)Sc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C11H11NO4S/c1-3-6-12-10(13)7(2)17-9-5-4-8(16-9)11(14)15/h1,4-5,7H,6H2,2H3,(H,12,13)(H,14,15) |
| InChIKey | VULITDZGSPVHLK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|