C12H9BrCl2O2 — CID 63943607
1-(3-bromofuran-2-yl)-2-(2,6-dichlorophenyl)ethanol (PubChem CID 63943607) has the molecular formula C12H9BrCl2O2 and a molecular weight of 336.01 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-2-(2,6-dichlorophenyl)ethanol.
| Compound Name | 1-(3-bromofuran-2-yl)-2-(2,6-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 63943607 |
| Molecular Formula | C12H9BrCl2O2 |
| Molecular Weight | 336.01 g/mol |
| Exact Mass | 333.92 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-2-(2,6-dichlorophenyl)ethanol |
| SMILES | OC(Cc1c(Cl)cccc1Cl)c1occc1Br |
| InChI | InChI=1S/C12H9BrCl2O2/c13-8-4-5-17-12(8)11(16)6-7-9(14)2-1-3-10(7)15/h1-5,11,16H,6H2 |
| InChIKey | LZDMHJHTHCFQFB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.01 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |