C16H17N3 — CID 63944686
2-(2,4,5-trimethylphenyl)imidazo[1,2-a]pyridin-6-amine (PubChem CID 63944686) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-(2,4,5-trimethylphenyl)imidazo[1,2-a]pyridin-6-amine.
| Compound Name | 2-(2,4,5-trimethylphenyl)imidazo[1,2-a]pyridin-6-amine |
|---|---|
| PubChem CID | 63944686 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 2-(2,4,5-trimethylphenyl)imidazo[1,2-a]pyridin-6-amine |
| SMILES | Cc1cc(C)c(-c2cn3cc(N)ccc3n2)cc1C |
| InChI | InChI=1S/C16H17N3/c1-10-6-12(3)14(7-11(10)2)15-9-19-8-13(17)4-5-16(19)18-15/h4-9H,17H2,1-3H3 |
| InChIKey | XUMCTJHLMYIUCY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |