C13H8Cl2FN3 — CID 63946258
2-(2,4-dichloro-5-fluorophenyl)imidazo[1,2-a]pyridin-6-amine (PubChem CID 63946258) has the molecular formula C13H8Cl2FN3 and a molecular weight of 296.13 g/mol. Its IUPAC name is 2-(2,4-dichloro-5-fluorophenyl)imidazo[1,2-a]pyridin-6-amine.
| Compound Name | 2-(2,4-dichloro-5-fluorophenyl)imidazo[1,2-a]pyridin-6-amine |
|---|---|
| PubChem CID | 63946258 |
| Molecular Formula | C13H8Cl2FN3 |
| Molecular Weight | 296.13 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | 2-(2,4-dichloro-5-fluorophenyl)imidazo[1,2-a]pyridin-6-amine |
| SMILES | Nc1ccc2nc(-c3cc(F)c(Cl)cc3Cl)cn2c1 |
| InChI | InChI=1S/C13H8Cl2FN3/c14-9-4-10(15)11(16)3-8(9)12-6-19-5-7(17)1-2-13(19)18-12/h1-6H,17H2 |
| InChIKey | JVDMJCJGDZCVFT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.13 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|