C15H24BrNO — CID 63946322
3-bromo-N-heptan-3-yl-2-(methoxymethyl)aniline (PubChem CID 63946322) has the molecular formula C15H24BrNO and a molecular weight of 314.27 g/mol. Its IUPAC name is 3-bromo-N-heptan-3-yl-2-(methoxymethyl)aniline.
| Compound Name | 3-bromo-N-heptan-3-yl-2-(methoxymethyl)aniline |
|---|---|
| PubChem CID | 63946322 |
| Molecular Formula | C15H24BrNO |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 3-bromo-N-heptan-3-yl-2-(methoxymethyl)aniline |
| SMILES | CCCCC(CC)Nc1cccc(Br)c1COC |
| InChI | InChI=1S/C15H24BrNO/c1-4-6-8-12(5-2)17-15-10-7-9-14(16)13(15)11-18-3/h7,9-10,12,17H,4-6,8,11H2,1-3H3 |
| InChIKey | RHJJTUQBDOSPSN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |