C8H8N2O6S — CID 63946377
5-[2-(carbamoylamino)-2-oxoethyl]sulfinylfuran-2-carboxylic acid (PubChem CID 63946377) has the molecular formula C8H8N2O6S and a molecular weight of 260.23 g/mol. Its IUPAC name is 5-[2-(carbamoylamino)-2-oxoethyl]sulfinylfuran-2-carboxylic acid.
| Compound Name | 5-[2-(carbamoylamino)-2-oxoethyl]sulfinylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 63946377 |
| Molecular Formula | C8H8N2O6S |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 5-[2-(carbamoylamino)-2-oxoethyl]sulfinylfuran-2-carboxylic acid |
| SMILES | NC(=O)NC(=O)CS(=O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C8H8N2O6S/c9-8(14)10-5(11)3-17(15)6-2-1-4(16-6)7(12)13/h1-2H,3H2,(H,12,13)(H3,9,10,11,14) |
| InChIKey | NAALHDUHKKWHIK-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |