C8H10N2O5S — CID 123122626
5-[(2-hydrazinyl-2-oxoethyl)sulfinylmethyl]furan-2-carboxylic acid (PubChem CID 123122626) has the molecular formula C8H10N2O5S and a molecular weight of 246.24 g/mol. Its IUPAC name is 5-[(2-hydrazinyl-2-oxoethyl)sulfinylmethyl]furan-2-carboxylic acid.
| Compound Name | 5-[(2-hydrazinyl-2-oxoethyl)sulfinylmethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 123122626 |
| Molecular Formula | C8H10N2O5S |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 5-[(2-hydrazinyl-2-oxoethyl)sulfinylmethyl]furan-2-carboxylic acid |
| SMILES | NNC(=O)CS(=O)Cc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C8H10N2O5S/c9-10-7(11)4-16(14)3-5-1-2-6(15-5)8(12)13/h1-2H,3-4,9H2,(H,10,11)(H,12,13) |
| InChIKey | DVCZKDHNVQHZAV-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|