C13H18O6S — CID 123122682
5-[(1-butan-2-yloxy-1-oxopropan-2-yl)sulfinylmethyl]furan-2-carboxylic acid (PubChem CID 123122682) has the molecular formula C13H18O6S and a molecular weight of 302.35 g/mol. Its IUPAC name is 5-[(1-butan-2-yloxy-1-oxopropan-2-yl)sulfinylmethyl]furan-2-carboxylic acid.
| Compound Name | 5-[(1-butan-2-yloxy-1-oxopropan-2-yl)sulfinylmethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 123122682 |
| Molecular Formula | C13H18O6S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 5-[(1-butan-2-yloxy-1-oxopropan-2-yl)sulfinylmethyl]furan-2-carboxylic acid |
| SMILES | CCC(C)OC(=O)C(C)S(=O)Cc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C13H18O6S/c1-4-8(2)18-13(16)9(3)20(17)7-10-5-6-11(19-10)12(14)15/h5-6,8-9H,4,7H2,1-3H3,(H,14,15) |
| InChIKey | MJTSWWRNGAECBH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |