C16H23N3O — CID 63946916
N-heptan-3-yl-2-methyl-5-(1,3,4-oxadiazol-2-yl)aniline (PubChem CID 63946916) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is N-heptan-3-yl-2-methyl-5-(1,3,4-oxadiazol-2-yl)aniline.
| Compound Name | N-heptan-3-yl-2-methyl-5-(1,3,4-oxadiazol-2-yl)aniline |
|---|---|
| PubChem CID | 63946916 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N-heptan-3-yl-2-methyl-5-(1,3,4-oxadiazol-2-yl)aniline |
| SMILES | CCCCC(CC)Nc1cc(-c2nnco2)ccc1C |
| InChI | InChI=1S/C16H23N3O/c1-4-6-7-14(5-2)18-15-10-13(9-8-12(15)3)16-19-17-11-20-16/h8-11,14,18H,4-7H2,1-3H3 |
| InChIKey | LQPLAOWYIGOYBV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |