C9H16N4OS — CID 63958587
3-amino-5-methyl-N-(3-methylsulfanylpropyl)-1H-pyrazole-4-carboxamide (PubChem CID 63958587) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is 3-amino-5-methyl-N-(3-methylsulfanylpropyl)-1H-pyrazole-4-carboxamide.
| Compound Name | 3-amino-5-methyl-N-(3-methylsulfanylpropyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 63958587 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-amino-5-methyl-N-(3-methylsulfanylpropyl)-1H-pyrazole-4-carboxamide |
| SMILES | CSCCCNC(=O)c1c(N)n[nH]c1C |
| InChI | InChI=1S/C9H16N4OS/c1-6-7(8(10)13-12-6)9(14)11-4-3-5-15-2/h3-5H2,1-2H3,(H,11,14)(H3,10,12,13) |
| InChIKey | YMYRYHDKCNENMY-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|