C5H9N3OS2 — CID 63959363
4-(2-methylsulfanylethyl)-5-sulfanylidene-1,2,4-triazolidin-3-one (PubChem CID 63959363) has the molecular formula C5H9N3OS2 and a molecular weight of 191.28 g/mol. Its IUPAC name is 4-(2-methylsulfanylethyl)-5-sulfanylidene-1,2,4-triazolidin-3-one.
| Compound Name | 4-(2-methylsulfanylethyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 63959363 |
| Molecular Formula | C5H9N3OS2 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | 4-(2-methylsulfanylethyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
| SMILES | CSCCn1c(=O)[nH][nH]c1=S |
| InChI | InChI=1S/C5H9N3OS2/c1-11-3-2-8-4(9)6-7-5(8)10/h2-3H2,1H3,(H,6,9)(H,7,10) |
| InChIKey | YAKMJRVIQKOWEK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 53.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|