C14H24BNO3 — CID 63967318
[4-methoxy-3-[[methyl(2-methylbutan-2-yl)amino]methyl]phenyl]boronic acid (PubChem CID 63967318) has the molecular formula C14H24BNO3 and a molecular weight of 265.16 g/mol. Its IUPAC name is [4-methoxy-3-[[methyl(2-methylbutan-2-yl)amino]methyl]phenyl]boronic acid.
| Compound Name | [4-methoxy-3-[[methyl(2-methylbutan-2-yl)amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 63967318 |
| Molecular Formula | C14H24BNO3 |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | [4-methoxy-3-[[methyl(2-methylbutan-2-yl)amino]methyl]phenyl]boronic acid |
| SMILES | CCC(C)(C)N(C)Cc1cc(B(O)O)ccc1OC |
| InChI | InChI=1S/C14H24BNO3/c1-6-14(2,3)16(4)10-11-9-12(15(17)18)7-8-13(11)19-5/h7-9,17-18H,6,10H2,1-5H3 |
| InChIKey | KHSRPKFJTUPXQW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|