C13H21BO3S — CID 107754390
[4-methoxy-3-(3-methylbutylsulfanylmethyl)phenyl]boronic acid (PubChem CID 107754390) has the molecular formula C13H21BO3S and a molecular weight of 268.19 g/mol. Its IUPAC name is [4-methoxy-3-(3-methylbutylsulfanylmethyl)phenyl]boronic acid.
| Compound Name | [4-methoxy-3-(3-methylbutylsulfanylmethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 107754390 |
| Molecular Formula | C13H21BO3S |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | [4-methoxy-3-(3-methylbutylsulfanylmethyl)phenyl]boronic acid |
| SMILES | COc1ccc(B(O)O)cc1CSCCC(C)C |
| InChI | InChI=1S/C13H21BO3S/c1-10(2)6-7-18-9-11-8-12(14(15)16)4-5-13(11)17-3/h4-5,8,10,15-16H,6-7,9H2,1-3H3 |
| InChIKey | UOZLPRSYPOXYBY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|