C13H19FO2S — CID 110923614
5-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]pentan-1-ol (PubChem CID 110923614) has the molecular formula C13H19FO2S and a molecular weight of 258.36 g/mol. Its IUPAC name is 5-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]pentan-1-ol.
| Compound Name | 5-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]pentan-1-ol |
|---|---|
| PubChem CID | 110923614 |
| Molecular Formula | C13H19FO2S |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 5-[(5-fluoro-2-methoxyphenyl)methylsulfanyl]pentan-1-ol |
| SMILES | COc1ccc(F)cc1CSCCCCCO |
| InChI | InChI=1S/C13H19FO2S/c1-16-13-6-5-12(14)9-11(13)10-17-8-4-2-3-7-15/h5-6,9,15H,2-4,7-8,10H2,1H3 |
| InChIKey | MOGZAJXTBSHHQV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|