C11H12ClFOS — CID 86882684
2-(2-chloroprop-2-enylsulfanylmethyl)-4-fluoro-1-methoxybenzene (PubChem CID 86882684) has the molecular formula C11H12ClFOS and a molecular weight of 246.73 g/mol. Its IUPAC name is 2-(2-chloroprop-2-enylsulfanylmethyl)-4-fluoro-1-methoxybenzene.
| Compound Name | 2-(2-chloroprop-2-enylsulfanylmethyl)-4-fluoro-1-methoxybenzene |
|---|---|
| PubChem CID | 86882684 |
| Molecular Formula | C11H12ClFOS |
| Molecular Weight | 246.73 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 2-(2-chloroprop-2-enylsulfanylmethyl)-4-fluoro-1-methoxybenzene |
| SMILES | C=C(Cl)CSCc1cc(F)ccc1OC |
| InChI | InChI=1S/C11H12ClFOS/c1-8(12)6-15-7-9-5-10(13)3-4-11(9)14-2/h3-5H,1,6-7H2,2H3 |
| InChIKey | NXEVODPQKZUKCC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.73 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |