C15H22BNO3 — CID 115561279
[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-4-methoxyphenyl]boronic acid (PubChem CID 115561279) has the molecular formula C15H22BNO3 and a molecular weight of 275.16 g/mol. Its IUPAC name is [3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-4-methoxyphenyl]boronic acid.
| Compound Name | [3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-4-methoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 115561279 |
| Molecular Formula | C15H22BNO3 |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | [3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-4-methoxyphenyl]boronic acid |
| SMILES | COc1ccc(B(O)O)cc1CN1CC2CCCC2C1 |
| InChI | InChI=1S/C15H22BNO3/c1-20-15-6-5-14(16(18)19)7-13(15)10-17-8-11-3-2-4-12(11)9-17/h5-7,11-12,18-19H,2-4,8-10H2,1H3 |
| InChIKey | XANLRGBJYQWCHB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|