C19H30BNO5 — CID 69166165
[4-methoxy-3-[[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]methyl]phenyl]boronic acid (PubChem CID 69166165) has the molecular formula C19H30BNO5 and a molecular weight of 363.26 g/mol. Its IUPAC name is [4-methoxy-3-[[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]methyl]phenyl]boronic acid.
| Compound Name | [4-methoxy-3-[[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 69166165 |
| Molecular Formula | C19H30BNO5 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | [4-methoxy-3-[[[4-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexyl]amino]methyl]phenyl]boronic acid |
| SMILES | COc1ccc(B(O)O)cc1CNC1CCC(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H30BNO5/c1-19(2,3)26-18(22)13-5-8-16(9-6-13)21-12-14-11-15(20(23)24)7-10-17(14)25-4/h7,10-11,13,16,21,23-24H,5-6,8-9,12H2,1-4H3 |
| InChIKey | HVTDHJCABBTVIZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|