C10H22N2OS — CID 63967363
N-ethyl-3-[(2-methyl-3-methylsulfanylpropyl)amino]propanamide (PubChem CID 63967363) has the molecular formula C10H22N2OS and a molecular weight of 218.37 g/mol. Its IUPAC name is N-ethyl-3-[(2-methyl-3-methylsulfanylpropyl)amino]propanamide.
| Compound Name | N-ethyl-3-[(2-methyl-3-methylsulfanylpropyl)amino]propanamide |
|---|---|
| PubChem CID | 63967363 |
| Molecular Formula | C10H22N2OS |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | N-ethyl-3-[(2-methyl-3-methylsulfanylpropyl)amino]propanamide |
| SMILES | CCNC(=O)CCNCC(C)CSC |
| InChI | InChI=1S/C10H22N2OS/c1-4-12-10(13)5-6-11-7-9(2)8-14-3/h9,11H,4-8H2,1-3H3,(H,12,13) |
| InChIKey | LXLWVFABOCNVCR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|