C9H19NO2S — CID 63966934
2-methyl-3-[(2-methyl-3-methylsulfanylpropyl)amino]propanoic acid (PubChem CID 63966934) has the molecular formula C9H19NO2S and a molecular weight of 205.32 g/mol. Its IUPAC name is 2-methyl-3-[(2-methyl-3-methylsulfanylpropyl)amino]propanoic acid.
| Compound Name | 2-methyl-3-[(2-methyl-3-methylsulfanylpropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 63966934 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-methyl-3-[(2-methyl-3-methylsulfanylpropyl)amino]propanoic acid |
| SMILES | CSCC(C)CNCC(C)C(=O)O |
| InChI | InChI=1S/C9H19NO2S/c1-7(6-13-3)4-10-5-8(2)9(11)12/h7-8,10H,4-6H2,1-3H3,(H,11,12) |
| InChIKey | GXPPDWWSASJURU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |