C10H20N2O3S — CID 63959874
2-[methyl-[(2-methyl-3-methylsulfanylpropyl)carbamoyl]amino]propanoic acid (PubChem CID 63959874) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-[methyl-[(2-methyl-3-methylsulfanylpropyl)carbamoyl]amino]propanoic acid.
| Compound Name | 2-[methyl-[(2-methyl-3-methylsulfanylpropyl)carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 63959874 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-[methyl-[(2-methyl-3-methylsulfanylpropyl)carbamoyl]amino]propanoic acid |
| SMILES | CSCC(C)CNC(=O)N(C)C(C)C(=O)O |
| InChI | InChI=1S/C10H20N2O3S/c1-7(6-16-4)5-11-10(15)12(3)8(2)9(13)14/h7-8H,5-6H2,1-4H3,(H,11,15)(H,13,14) |
| InChIKey | KGBZSWDLICADPJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |