C13H22N2O2S2 — CID 63981200
N,N-dimethyl-4-[1-(2-methylsulfanylethylamino)ethyl]benzenesulfonamide (PubChem CID 63981200) has the molecular formula C13H22N2O2S2 and a molecular weight of 302.47 g/mol. Its IUPAC name is N,N-dimethyl-4-[1-(2-methylsulfanylethylamino)ethyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-4-[1-(2-methylsulfanylethylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63981200 |
| Molecular Formula | C13H22N2O2S2 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N,N-dimethyl-4-[1-(2-methylsulfanylethylamino)ethyl]benzenesulfonamide |
| SMILES | CSCCNC(C)c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C13H22N2O2S2/c1-11(14-9-10-18-4)12-5-7-13(8-6-12)19(16,17)15(2)3/h5-8,11,14H,9-10H2,1-4H3 |
| InChIKey | OHCXNBMQJLAVBD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|