C19H26N2O4S — CID 71862788
4-[1-[2-(4-methoxyphenoxy)ethylamino]ethyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 71862788) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is 4-[1-[2-(4-methoxyphenoxy)ethylamino]ethyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[1-[2-(4-methoxyphenoxy)ethylamino]ethyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 71862788 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 4-[1-[2-(4-methoxyphenoxy)ethylamino]ethyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | COc1ccc(OCCNC(C)c2ccc(S(=O)(=O)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H26N2O4S/c1-15(16-5-11-19(12-6-16)26(22,23)21(2)3)20-13-14-25-18-9-7-17(24-4)8-10-18/h5-12,15,20H,13-14H2,1-4H3 |
| InChIKey | RSFZOXQWMWVHLY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|