C13H21NS2 — CID 63981496
N-[cyclopropyl(thiophen-2-yl)methyl]-2-methyl-3-methylsulfanylpropan-1-amine (PubChem CID 63981496) has the molecular formula C13H21NS2 and a molecular weight of 255.45 g/mol. Its IUPAC name is N-[cyclopropyl(thiophen-2-yl)methyl]-2-methyl-3-methylsulfanylpropan-1-amine.
| Compound Name | N-[cyclopropyl(thiophen-2-yl)methyl]-2-methyl-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 63981496 |
| Molecular Formula | C13H21NS2 |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | N-[cyclopropyl(thiophen-2-yl)methyl]-2-methyl-3-methylsulfanylpropan-1-amine |
| SMILES | CSCC(C)CNC(c1cccs1)C1CC1 |
| InChI | InChI=1S/C13H21NS2/c1-10(9-15-2)8-14-13(11-5-6-11)12-4-3-7-16-12/h3-4,7,10-11,13-14H,5-6,8-9H2,1-2H3 |
| InChIKey | VXBHNCLEOXBQRS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |